| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | [4-(4-Fluoro-phenyl)-thiazol-2-yl]-methanol Basic information |
| | [4-(4-Fluoro-phenyl)-thiazol-2-yl]-methanol Chemical Properties |
| Boiling point | 347.2±27.0 °C(Predicted) | | density | 1.346±0.06 g/cm3(Predicted) | | form | solid | | pka | 13.00±0.10(Predicted) | | InChI | 1S/C10H8FNOS/c11-8-3-1-7(2-4-8)9-6-14-10(5-13)12-9/h1-4,6,13H,5H2 | | InChIKey | SDZNQPGOGCLEII-UHFFFAOYSA-N | | SMILES | FC1=CC=C(C=C1)C2=CSC(CO)=N2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | [4-(4-Fluoro-phenyl)-thiazol-2-yl]-methanol Usage And Synthesis |
| | [4-(4-Fluoro-phenyl)-thiazol-2-yl]-methanol Preparation Products And Raw materials |
|