| Company Name: |
Selectoprobe Gold |
| Tel: |
15156792748 |
| Email: |
li_kang@selectoprobe.com |
|
| | CALCIUM IONOPHORE II Basic information |
| Product Name: | CALCIUM IONOPHORE II | | Synonyms: | N,N,N',N'-TETRACYCLOHEXYL-3-OXAPENTANEDIAMIDE;CALCIUM IONOPHORE II;ETH 129, N,N,Nμ,Nμ-Tetra[cyclohexyl]diglycolic acid diamide, N,N,Nμ,Nμ-Tetracyclohexyl-3-oxapentanediamide;Acetamide, 2,2'-oxybis[N,N-dicyclohexyl-;2,2'-Oxybis(N,N-dicyclohexylacetamide);N,N-DICYCLOHEXYL-2-[(DICYCLOHEXYLCARBAMOYL)METHOXY]ACETAMIDE;N,N,N′,N′-Tetracyclohexyl-3-oxapentanediamide (Calcium ionoph;ETH 129 | | CAS: | 74267-27-9 | | MF: | C28H48N2O3 | | MW: | 460.69 | | EINECS: | | | Product Categories: | | | Mol File: | 74267-27-9.mol |  |
| | CALCIUM IONOPHORE II Chemical Properties |
| Boiling point | 613.7±44.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Ethanol: 1 mg/ml | | form | A solid | | pka | -0.68±0.20(Predicted) | | color | White to off-white | | BRN | 6491651 | | InChI | 1S/C28H48N2O3/c31-27(29(23-13-5-1-6-14-23)24-15-7-2-8-16-24)21-33-22-28(32)30(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h23-26H,1-22H2 | | InChIKey | URAUKAJXWWFQSU-UHFFFAOYSA-N | | SMILES | O=C(COCC(=O)N(C1CCCCC1)C2CCCCC2)N(C3CCCCC3)C4CCCCC4 |
| Hazard Codes | Xi | | Risk Statements | 37 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CALCIUM IONOPHORE II Usage And Synthesis |
| Uses | Suitable for intracellular calcium measurements. | | General Description | Visit our Sensor Applications portal to learn more. | | Purification Methods | Recrystallise it from Me2CO. It forms 1:2 and 1:3 metal/ligand complexes with Mg2+ and Ca2+ ions, respectively, and induces selectivity in membranes for Ca2+ over Mg2+ by a factor of ca 104. [Pretsch et al. Helv Chim Acta 63 191 1980, Simon & Carafoli Methods Enzymol 56 439 1977.] |
| | CALCIUM IONOPHORE II Preparation Products And Raw materials |
|