| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | (3,4-Dihydroxyphenyl)(4-Methylphenyl)Methanone Basic information |
| Product Name: | (3,4-Dihydroxyphenyl)(4-Methylphenyl)Methanone | | Synonyms: | (3,4-Dihydroxyphenyl)(4-Methylphenyl)Methanone;Denitro Tolcapone;(3,4-dihydroxyphenyl)(p-tolyl)methanone;(3,4-dihydroxyphenyl)(p-tolyl)methanone(WXC05594);4'-Methyl-3,4-dihydroxybenzophenone;Methanone, (3,4-dihydroxyphenyl)(4-methylphenyl)-;Tolcapone Related Compound A(Secondary Standards traceble to USP);Tolcapone USP Related Compound A | | CAS: | 1391053-03-4 | | MF: | C14H12O3 | | MW: | 228.24 | | EINECS: | | | Product Categories: | Aromatics;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Aromatics, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 1391053-03-4.mol |  |
| | (3,4-Dihydroxyphenyl)(4-Methylphenyl)Methanone Chemical Properties |
| Major Application | pharmaceutical (small molecule) | | InChI | 1S/C14H12O3/c1-9-2-4-10(5-3-9)14(17)11-6-7-12(15)13(16)8-11/h2-8,15-16H,1H3 | | InChIKey | YNUSEKORCRKLMQ-UHFFFAOYSA-N | | SMILES | Oc1c(ccc(c1)C(=O)c2ccc(cc2)C)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (3,4-Dihydroxyphenyl)(4-Methylphenyl)Methanone Usage And Synthesis |
| Uses | An impurity of Tolcapone (T535250). |
| | (3,4-Dihydroxyphenyl)(4-Methylphenyl)Methanone Preparation Products And Raw materials |
|