| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:11β-Hydroxytestosterone
CAS:1816-85-9
Package:500Mg,50Mg
|
|
| | 11BETA-HYDROXYTESTOSTERONE Basic information | | Uses |
| Product Name: | 11BETA-HYDROXYTESTOSTERONE | | Synonyms: | 11-hydroxytestosterone;11BETA-HYDROXYTESTOSTERONE;4-ANDROSTEN-11-BETA, 17-BETA-DIOL-3-ONE;4-ANDROSTENE-11BETA,17BETA-DIOL-3-ONE;11B-hydroxytestosterone--dea*schedule iii;11β,17β-dihydroxyandrost-4-en-3-one;4-Androstene-11B,17B-diol-3-one;11β,17β-Dihydroxyandrost-4-en-3-one, 4-Androstene-11β,17β-diol-3-one | | CAS: | 1816-85-9 | | MF: | C19H28O3 | | MW: | 304.42 | | EINECS: | | | Product Categories: | | | Mol File: | 1816-85-9.mol |  |
| | 11BETA-HYDROXYTESTOSTERONE Chemical Properties |
| Melting point | 234.5-235.5 °C | | Boiling point | 476.2±45.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol: Soluble | | form | crystalline | | pka | 14.56±0.70(Predicted) | | color | light yellow | | InChI | InChI=1/C19H28O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-17,21-22H,3-8,10H2,1-2H3/t13-,14-,15-,16-,17+,18-,19-/s3 | | InChIKey | YQDZGFAYWGWSJK-PUDAZTTPNA-N | | SMILES | [C@]12([H])[C@@H](O)C[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CCC1=CC(=O)CC[C@]21C)O |&1:0,2,5,7,10,12,22,r| |
| | 11BETA-HYDROXYTESTOSTERONE Usage And Synthesis |
| Uses | 11BETA-hydroxytestosterone may be used as a drug in human or animal subjects for the prevention or reversal of mitochondrial damage, for the treatment or prevention of diseases related to mitochondrial dysfunction or depletion, and for inducing mitochondrial regeneration or remodeling as a means of treating diseases related to mitochondrial structural and functional abnormalities. | | Description | 11β-hydroxy Testosterone is a metabolite of testosterone.1 It is formed from testosterone primarily by the cytochrome P450 (CYP) isoform CYP3A4.WARNING This product is not for human or veterinary use. | | Definition | ChEBI: 11beta-hydroxytestosterone is an androstanoid that is testosterone carrying an additional hydroxy substituent at the 11beta-position. It has a role as a bacterial xenobiotic metabolite, a human xenobiotic metabolite and a marine metabolite. It is a 17beta-hydroxy steroid, a 3-oxo-Delta(4) steroid, an androstanoid, a C19-steroid and an 11beta-hydroxy steroid. It is functionally related to a testosterone. | | References | [1] MAN HO CHOI. Characterization of testosterone 11 beta-hydroxylation catalyzed by human liver microsomal cytochromes P450.[J]. Drug Metabolism and Disposition, 2005, 33 6: 714-718. DOI: 10.1124/dmd.104.003327 |
| | 11BETA-HYDROXYTESTOSTERONE Preparation Products And Raw materials |
|