|
|
| | 4-Butoxyphenylacetic acid methyl ester Basic information |
| Product Name: | 4-Butoxyphenylacetic acid methyl ester | | Synonyms: | METHYL 4-BUTOXYBENZENEACETATE;METHYL 4-BUTOXYPHENYLACETATE;butoxyphenylaceticacidmethylester;METHYL 2-(4-BUTOXYPHENYL)ACETATE;Methyl p-butoxyphenylacetate;(p-Butoxyphenyl)acetic acid methyl ester;Bufexamac impurity B CRS;Bufexamac EP Impurity B | | CAS: | 29056-06-2 | | MF: | C13H18O3 | | MW: | 222.28 | | EINECS: | 249-392-7 | | Product Categories: | Aromatic Esters | | Mol File: | 29056-06-2.mol |  |
| | 4-Butoxyphenylacetic acid methyl ester Chemical Properties |
| Boiling point | 143 °C / 1mmHg | | density | 1.04 | | storage temp. | 2-8°C | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H18O3/c1-3-4-9-16-12-7-5-11(6-8-12)10-13(14)15-2/h5-8H,3-4,9-10H2,1-2H3 | | InChIKey | IEPLOMKGNGXJAW-UHFFFAOYSA-N | | SMILES | O(CCCC)c1ccc(cc1)CC(=O)OC | | CAS DataBase Reference | 29056-06-2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-Butoxyphenylacetic acid methyl ester Usage And Synthesis |
| Uses | Bufexamac impurity B EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| | 4-Butoxyphenylacetic acid methyl ester Preparation Products And Raw materials |
|