| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3,3',5'-Triiodothyronine-(diiodophenyl-13C6) hydrochloride Basic information |
| Product Name: | 3,3',5'-Triiodothyronine-(diiodophenyl-13C6) hydrochloride | | Synonyms: | 3,3',5'-Triiodothyronine-(diiodophenyl-13C6) hydrochloride;Ferulic acid-[13C3];Reverse Triiodothyronine-[diiodophenyl-ring-13C6] hydrochloride (Rev T3);REVERSE 3,3',5-TRIIODO-L-THYRONINE:HCL (REV T3) (DIIODOPHENYL-RING-13C6,99%)100UG/ML 0.1N NH3/MEOH;Reverse Triiodothyronine-[diiodophenyl-ring-13C6] Hydrochloride (Rev T3) (Solution);REVERSE 3,3',5-TRIIODO-L-THYRONINE:HCL (REV T3) (DIIODOPHENYL-RING-13C6,99%) 95% CP;-Triiodothyronine-(diiodophenyl-13C6)hydrochloride;diiodophenyl-ring-13C6]-Reverse Triiodothyronine hydrochloride (Reverse T3) | | CAS: | 1217676-14-6 | | MF: | C15H13ClI3NO4 | | MW: | 693.48843 | | EINECS: | | | Product Categories: | | | Mol File: | 1217676-14-6.mol |  |
| | 3,3',5'-Triiodothyronine-(diiodophenyl-13C6) hydrochloride Chemical Properties |
| storage temp. | -20°C | | form | powder | | InChIKey | YCBXNJGXKMWFLL-UKPPHBCASA-N | | SMILES | Cl.N[C@@H](Cc1ccc(O[13c]2[13cH][13c](I)[13c](O)[13c](I)[13cH]2)c(I)c1)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2845909090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3,3',5'-Triiodothyronine-(diiodophenyl-13C6) hydrochloride Usage And Synthesis |
| Uses | 3,3’,5’-Triiodothyronine-(diiodophenyl-13C6) Hydrochloride is a useful building block in the synthesis of various pharmaceuticals. |
| | 3,3',5'-Triiodothyronine-(diiodophenyl-13C6) hydrochloride Preparation Products And Raw materials |
|