| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
Tetrahydropentalene-2,5-dione manufacturers
|
| | Tetrahydropentalene-2,5-dione Basic information |
| Product Name: | Tetrahydropentalene-2,5-dione | | Synonyms: | ETRAHYDROPENTALENE-2,5-DIONE;RARECHEM AQ BC 8009;(3as,6as)-tetrahydropentalene-2,5(1H,3H)-dione;2,5(1H,3H)-Pentalenedione,tetrahydro-;NSC 139193;Tetrahydropentalene-2,5(1H,3H);dicyclo[3.3.0]octylalkane-3,7-dione;tetrahydropentalene-2,5(1H,3H)-dione | | CAS: | 74513-16-9 | | MF: | C8H10O2 | | MW: | 138.16 | | EINECS: | | | Product Categories: | | | Mol File: | 74513-16-9.mol |  |
| | Tetrahydropentalene-2,5-dione Chemical Properties |
| Melting point | 83-85 °C | | Boiling point | 268.277±33.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.192±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H10O2/c9-7-1-5-2-8(10)4-6(5)3-7/h5-6H,1-4H2 | | InChIKey | HAFQHNGZPQYKFF-UHFFFAOYSA-N | | SMILES | C1C2C(CC(=O)C2)CC1=O |
| | Tetrahydropentalene-2,5-dione Usage And Synthesis |
| Uses | Tetrahydro-2,5(1H,3H)-pentalenedione is a useful compound in preparation of thioacetals via thioacetalization of carbonyl compounds with thiols. |
| | Tetrahydropentalene-2,5-dione Preparation Products And Raw materials |
|