- NaTf2N
-
- $2.00
-
2019-12-31
- CAS:91742-21-1
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20tons
|
| | SodiuM bis(trifluoroMethylsulfonyl)iMide Basic information | | Preparation |
| Product Name: | SodiuM bis(trifluoroMethylsulfonyl)iMide | | Synonyms: | SodiuM bis(trifluoroMethylsulfonyl)iMide;SodiuM trifluoroMethanesulfoniMide, Min. 97%;Sodium trifluoromethanesulfonimide 97%;NaTf2N;sodium bis(trifluoromethylsulfonyl)azanide;Na[(CF3SO2)2N]NaTFSI;Bis(trifluoromethanesulfonyl)imide Sodium Salt;Sodium Triflimide | | CAS: | 91742-21-1 | | MF: | C2F6NNaO4S2 | | MW: | 303.1358892 | | EINECS: | 804-361-2 | | Product Categories: | | | Mol File: | 91742-21-1.mol |  |
| | SodiuM bis(trifluoroMethylsulfonyl)iMide Chemical Properties |
| Melting point | 257-258℃ | | Boiling point | 400℃ at 101.3kPa | | density | 2.15 g/cm3 | | vapor pressure | 0Pa at 25℃ | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | Soluble in water | | form | Powder | | color | white | | Sensitive | Moisture Sensitive | | Stability: | hygroscopic | | Major Application | battery manufacturing | | InChI | InChI=1S/C2F6NO4S2.Na/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1;+1 | | InChIKey | YLKTWKVVQDCJFL-UHFFFAOYSA-N | | SMILES | [Na+].[N-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F | | LogP | 0.73 at 20℃ |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGIII | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2935.90.9500 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | SodiuM bis(trifluoroMethylsulfonyl)iMide Usage And Synthesis |
| Preparation | The most common preparation method for SodiuM bis(trifluoroMethylsulfonyl)iMide is the reaction of trifluoromethanesulfonic acid (TfOH) with metallic sodium or organic amines. | | Chemical Properties | Sodium bis(trifluoromethylsulfonyl)imide, a white to light yellow solid, is highly chemically and thermally stable. It is readily soluble in organic solvents such as acetonitrile and dimethyl sulfoxide, but virtually insoluble in water. This property makes it an ideal reagent in organic synthesis because it disperses and reacts well in organic solvents. | | Uses | Sodium bis(trifluoromethylsulfonyl)imide is used as an electrolyte in batteries and fuel cells. It also finds use as an ionic liquid and Lewis acid. |
| | SodiuM bis(trifluoroMethylsulfonyl)iMide Preparation Products And Raw materials |
|