|
|
| | tert-butyl 1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-ylcarbaMate Basic information |
| Product Name: | tert-butyl 1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-ylcarbaMate | | Synonyms: | 2-(Boc-amino)-1-(2,5-difluorophenyl)-4-pentyn-1-one;tert-butyl N-[1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-yl]carbamate;tert-butyl 1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-ylcarbaMate;tert-Butyl [1-(2,5-difluorophenyl)-1-oxo-4-pentyn-2-yl]carbamate;Carbamic acid, N-[1-(2,5-difluorobenzoyl)-3-butyn-1-yl]-, 1,1-dimethylethyl ester;tert-butyl[1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-yl]carbam...;TB-2123 | | CAS: | 1172623-96-9 | | MF: | C16H17F2NO3 | | MW: | 309.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1172623-96-9.mol |  |
| | tert-butyl 1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-ylcarbaMate Chemical Properties |
| Boiling point | 429.7±45.0 °C(Predicted) | | density | 1.199±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.20±0.46(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C16H17F2NO3/c1-5-6-13(19-15(21)22-16(2,3)4)14(20)11-9-10(17)7-8-12(11)18/h1,7-9,13H,6H2,2-4H3,(H,19,21) | | InChIKey | FCPUEOMVOKWZQD-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC(C(=O)C1=CC(F)=CC=C1F)CC#C |
| | tert-butyl 1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-ylcarbaMate Usage And Synthesis |
| Uses | tert-Butyl (1-(2,5-Difluorophenyl)-1-oxopent-4-yn-2-yl)carbamate is used as a reactant in the preparation of a highly functionalized tetrahydropyran DPP-4 inhibitor. |
| | tert-butyl 1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-ylcarbaMate Preparation Products And Raw materials |
|