|
4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid Suppliers list
|
|
| | 4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid Basic information |
| Product Name: | 4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid | | Synonyms: | 4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid;Octanoic acid, 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-;3-Perfluoropentyl propanoic acid(5:3);4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid in Methanol;PFAS Native X:3 FTCAs Mixture 4-20 μg/mL in Methanol:Water;2H,2H,3H,3H-Perfluorooctanoic acid 50 μg/mL in Methanol:Water | | CAS: | 914637-49-3 | | MF: | C8H5F11O2 | | MW: | 342.11 | | EINECS: | | | Product Categories: | | | Mol File: | 914637-49-3.mol |  |
| | 4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid Chemical Properties |
| Boiling point | 199.0±35.0 °C(Predicted) | | density | 1.588±0.06 g/cm3(Predicted) | | solubility | DMF: 5 mg/ml,DMSO: 2 mg/ml,Ethanol: insol,PBS (pH 7.2): insol | | form | A solid | | pka | 4.18±0.10(Predicted) | | Major Application | PFAS testing
clinical testing
coatings
environmental
food and beverages | | InChI | InChI=1S/C8H5F11O2/c9-4(10,2-1-3(20)21)5(11,12)6(13,14)7(15,16)8(17,18)19/h1-2H2,(H,20,21) | | InChIKey | ABFCFCPCGMHSRX-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | 5:3 Polyfluorinated acid (914637-49-3) |
| WGK Germany | WGK 3 | | HS Code | 2915907098 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid Usage And Synthesis |
| Uses | 2H,2H,3H,3H-Perfluorooctanoic Acid is used in analytical studies for the identification of precursors and biodegradable products of perfluorinated and polyflorinated compounds using high resolution mass spectrometry. | | Definition | ChEBI: 53FTA is a medium-chain fatty acid. |
| | 4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid Preparation Products And Raw materials |
|