| Company Name: |
TCI (Shanghai) Chemical Trading Co., Ltd.
|
| Tel: |
021-61109150 |
| Email: |
sales@tcisct.com |
| Products Intro: |
Product Name:Tembotrione-4,6-dihydroxy
CAS:912654-91-2
Purity:根据客户需求提供 Package:1KG;10KG;100KG;
|
| Company Name: |
Shanghai Aitixi Biotechnology Co., Ltd
|
| Tel: |
18721763493 |
| Email: |
2493172863@qq.com |
| Products Intro: |
Product Name:Tembotrione metabolite AE 1417268
CAS:912654-91-2
Purity:98% Package:1g
|
|
| | Tembotrione metabolite AE 1417268
Basic information |
| Product Name: | Tembotrione metabolite AE 1417268
| | Synonyms: | Tembotrione metabolite AE 1417268
;1,3-Cyclohexanedione, 2-[2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl]-4,6-dihydroxy-;2-[2-Chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl]-4,6-dihydroxy-1,3-cyclohexanedione;Tembotrione-4,6-dihydroxy 10 μg/mL in Acetonitrile;Tembotrione-4,6-dihydroxy | | CAS: | 912654-91-2 | | MF: | C17H16ClF3O8S | | MW: | 472.82 | | EINECS: | | | Product Categories: | | | Mol File: | 912654-91-2.mol |  |
| | Tembotrione metabolite AE 1417268
Chemical Properties |
| Boiling point | 705.3±60.0 °C(Predicted) | | density | 1.596±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 1.46±0.70(Predicted) | | Major Application | agriculture
environmental | | InChI | 1S/C17H16ClF3O8S/c1-30(27,28)11-3-2-7(13(18)8(11)5-29-6-17(19,20)21)14(24)12-15(25)9(22)4-10(23)16(12)26/h2-3,9-10,12,22-23H,4-6H2,1H3 | | InChIKey | KGPIRVWYAUCFAI-UHFFFAOYSA-N | | SMILES | CS(=O)(=O)c1ccc(c(Cl)c1COCC(F)(F)F)C(=O)C2C(=O)C(O)CC(O)C2=O |
| Hazard Codes | Xi,N | | Risk Statements | 43-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Skin Sens. 1 |
| | Tembotrione metabolite AE 1417268
Usage And Synthesis |
| Uses | 2-[2-Chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl]-4,6-dihydroxy-1,3-cyclohexanedione can be used to treat alkaptonuria and tyrosinemia type 1 using inhibitors of 4-HPPD. |
| | Tembotrione metabolite AE 1417268
Preparation Products And Raw materials |
|