| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Umicore M73 SIMes Basic information |
| Product Name: | Umicore M73 SIMes | | Synonyms: | Dichloro[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene][(5-isobutoxycarbonylamino)-(2-isopropoxy)benzylidene]ruthenium(II);Umicore M73 SIMes;[1,3-Bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro[5-(isobutoxycarbonylamido)-2-isopropoxybenzylidene]ruthenium(II);(SP-5-41)-[1,3-Bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro[[2-(1-methylethoxy-κO)-5-[[(2-methylpropoxy)carbonyl]amino]phenyl]methylene-κC]ruthenium;Hoveyda-Grubbs Catalyst? M730;Hoveyda-Grubbs Catalyst? M730 | | CAS: | 1025728-57-7 | | MF: | C36H46Cl2N3O3Ru | | MW: | 740.75 | | EINECS: | | | Product Categories: | | | Mol File: | 1025728-57-7.mol |  |
| | Umicore M73 SIMes Chemical Properties |
| Melting point | 240-245°C (decomposition) | | storage temp. | 2-8°C | | form | solid | | InChIKey | FERSNXSBIXKVRT-UHFFFAOYSA-L | | SMILES | CC(C)OC1=C(C=C(NC(OCCCC)=O)C=C1)C=[Ru](Cl)(Cl)=C2N(C3=C(C)C=C(C)C=C3C)CCN2C4=C(C)C=C(C)C=C4C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | Umicore M73 SIMes Usage And Synthesis |
| reaction suitability | core: ruthenium
reagent type: catalyst |
| | Umicore M73 SIMes Preparation Products And Raw materials |
|