| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Di-p-toluoyl-D-tartaric acid monohydrate Basic information |
| | Di-p-toluoyl-D-tartaric acid monohydrate Chemical Properties |
| Melting point | 163-165 °C(lit.) | | alpha | 142 º (C=1 IN MEOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +142°, c = 1 in methanol | | InChI | InChI=1/C20H18O8.H2O/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);1H2/t15-,16-;/s3 | | InChIKey | FOTRUJUPLHRVNU-MOGJOVFKSA-N | | SMILES | C(O)(=O)[C@H]([C@@H](C(O)=O)OC(=O)C1=CC=C(C)C=C1)OC(=O)C1=CC=C(C)C=C1.[H]O[H] |&1:3,4,r| | | CAS DataBase Reference | 71607-31-3(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Di-p-toluoyl-D-tartaric acid monohydrate Usage And Synthesis |
| Chemical Properties | White to off-white powder or crystalline powder | | Uses | Di-p-toluoyl-d-tartaric Acid Monohydrate is a useful intermediate in the preparation of chiral rivastigmine hydrogen tartrate. |
| | Di-p-toluoyl-D-tartaric acid monohydrate Preparation Products And Raw materials |
|