| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fumaric acid monoethyl ester, magnesium salt Basic information |
| | Fumaric acid monoethyl ester, magnesium salt Chemical Properties |
| Melting point | 169 °C (dec.)(lit.) | | InChI | 1S/2C6H8O4.Mg/c2*1-2-10-6(9)4-3-5(7)8;/h2*3-4H,2H2,1H3,(H,7,8);/q;;+2/p-2/b2*4-3+; | | InChIKey | ZHLRSUSHKGQBNV-SYWGCQIGSA-L | | SMILES | CCOC(=O)\C=C\C(=O)O[Mg]OC(=O)\C=C\C(=O)OCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | Fumaric acid monoethyl ester, magnesium salt Usage And Synthesis |
| Uses | Fumaric Acid Monoethyl Ester Magnesium Salt, is the salt of Fumaric Acid Monoethyl Ester (F500385), which is an anti-psoriatic fumaric acid ester. Fumaric Acid Monoethyl Ester inhibited thymidine-14C incorporation into DNA by cultured human lymphocytes. Fumaric Acid Monoethyl Ester has been shown to evoke transient increase in intracellular free calcium concentration and inhibit proliferation of human keratinocytes. |
| | Fumaric acid monoethyl ester, magnesium salt Preparation Products And Raw materials |
|