| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N,N-Diisopropylethylamine p-toluenesulfonate Basic information |
| Product Name: | N,N-Diisopropylethylamine p-toluenesulfonate | | Synonyms: | N-ETHYLDIISOPROPYLAMINE P-TOLUENESULFONATE;N,N-Diisopropylethylamine p-toluenesulfonate salt;ethyldiisopropylammonium p-toluenesulphonate;N-ETHYL-N-ISOPROPYL-2-PROPANAMINIUM 4-METHYLBENZENESULFONATE;N,N-Diisopropylethylamine p-toluenesulfonate salt;N,N-Diisopropylethylamine p-toluenesulfonate | | CAS: | 62359-01-7 | | MF: | C15H27NO3S | | MW: | 301.44 | | EINECS: | 263-523-5 | | Product Categories: | | | Mol File: | 62359-01-7.mol |  |
| | N,N-Diisopropylethylamine p-toluenesulfonate Chemical Properties |
| Melting point | 86-88 °C (lit.) | | storage temp. | 2-8°C | | InChI | 1S/C8H19N.C7H8O3S/c1-6-9(7(2)3)8(4)5;1-6-2-4-7(5-3-6)11(8,9)10/h7-8H,6H2,1-5H3;2-5H,1H3,(H,8,9,10) | | InChIKey | WALRQYFNEKCLGF-UHFFFAOYSA-N | | SMILES | CCN(C(C)C)C(C)C.Cc1ccc(cc1)S(O)(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3259 8/PG 2 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N,N-Diisopropylethylamine p-toluenesulfonate Usage And Synthesis |
| Uses | N,N-Diisopropylethylamine p-toluenesulfonate salt may be used in the chemical synthesis studies. |
| | N,N-Diisopropylethylamine p-toluenesulfonate Preparation Products And Raw materials |
|