|
|
| | 2-METHYL-6-PROPOXYPYRAZINE Basic information |
| Product Name: | 2-METHYL-6-PROPOXYPYRAZINE | | Synonyms: | 2-N-PROPOXY-6-METHYLPYRAZINE;2-METHYL-6-PROPOXYPYRAZINE;2-methyl-6-propoxy-pyrazin;Pyrazine, 2-methyl-6-propoxy-;6-Methyl-2-propoxypyrazine;Inchi=1/C8H12N2o/C1-3-4-11-8-6-9-5-7(2)10-8/H5-6H,3-4H2,1-2h | | CAS: | 67845-28-7 | | MF: | C8H12N2O | | MW: | 152.19 | | EINECS: | 267-306-6 | | Product Categories: | | | Mol File: | 67845-28-7.mol |  |
| | 2-METHYL-6-PROPOXYPYRAZINE Chemical Properties |
| Boiling point | 211.9±35.0 °C(Predicted) | | density | 1.020±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 1.44±0.10(Predicted) | | Odor | green vegetable | | Odor Type | green | | LogP | 2.290 | | EPA Substance Registry System | 2-Methyl-6-propoxypyrazine (67845-28-7) |
| TSCA | TSCA listed | | HS Code | 2933998090 |
| | 2-METHYL-6-PROPOXYPYRAZINE Usage And Synthesis |
| | 2-METHYL-6-PROPOXYPYRAZINE Preparation Products And Raw materials |
|