- Cetirizine Impurity 35
-
- $0.00 / 10mg
-
2026-03-12
- CAS:300543-56-0
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
|
| | (R)-1-[(4-Chlorophenyl)phenylmethyl]piperazine Basic information |
| | (R)-1-[(4-Chlorophenyl)phenylmethyl]piperazine Chemical Properties |
| Melting point | 91-93oC | | Boiling point | 409.1±0.0 °C(Predicted) | | density | 1.158 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | pka | 8.99±0.10(Predicted) | | form | Solid | | color | White | | PH | 9.38 at 25℃ and 10.07g/L | | Water Solubility | Soluble in chloroform, methanol, and dichloromethane. Slightly soluble in water. | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1/C17H19ClN2/c18-16-8-6-15(7-9-16)17(14-4-2-1-3-5-14)20-12-10-19-11-13-20/h1-9,17,19H,10-13H2/t17-/s3 | | InChIKey | UZKBSZSTDQSMDR-SCBJWRGWNA-N | | SMILES | [C@@H](N1CCNCC1)(C1C=CC=CC=1)C1C=CC(Cl)=CC=1 |&1:0,r| | | CAS DataBase Reference | 300543-56-0 |
| WGK Germany | WGK 3 | | HS Code | 2933599550 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (R)-1-[(4-Chlorophenyl)phenylmethyl]piperazine Usage And Synthesis |
| Uses | Intermediate in the production of (R)-Cetirizine (C281106). | | Uses | (R)-1-[alpha-(4-Chlorophenyl)benzyl]piperazine intermediate in the production of (R)-Cetirizine. | | Application |
(R)-1-[(4-Chlorophenyl)phenylmethyl]piperazine could be used to synthesize a series of novel derivatives. Most of these derivatives significantly affected both allergic asthma and allergic itching. Meanwhile, in the test of allergic itching, five of the 19 compounds have more potent activities than levocetirizine[1].
| | References | [1] Lisheng Wang. “Design, synthesis, and anti-allergic activities of novel (R)(-)-1-[(4-chlorophenyl)phenyl methyl]piperazine derivatives.” Medicinal Chemistry Research 21 1 (2010): 124–132.
|
| | (R)-1-[(4-Chlorophenyl)phenylmethyl]piperazine Preparation Products And Raw materials |
|