|
|
| | Ala-D-gamma-Glu-Lys-D-Ala-D-Ala Basic information |
| Product Name: | Ala-D-gamma-Glu-Lys-D-Ala-D-Ala | | Synonyms: | Peptidoglycan pentapeptide;ala-d-γ-glu-lys-d-ala-d-ala;H-Ala-g-D-Glu-Lys-D-Ala-D-Ala-OH;ala-D-G-glu-lys-D-ala-D-ala;D-Alanine, L-alanyl-D-γ-glutamyl-L-lysyl-D-alanyl-;Ala-D-gamma-Glu-Lys-D-Ala-D-Ala >=97% (HPLC);L-Alanyl-D-γ-glutamyl-L-lysyl-D-alanyl-D-alanine;(2R,5R,8S,13R,16S)-16-Amino-8-(4-aminobutyl)-13-carboxy-2,5-dimethyl-4,7,10,15-tetraoxo-3,6,9,14-tetraazaheptadecan-1-oic acid | | CAS: | 2614-55-3 | | MF: | C20H36N6O8 | | MW: | 488.54 | | EINECS: | | | Product Categories: | Other Peptides;Peptides and Proteins;Peptides for Cell Biology | | Mol File: | 2614-55-3.mol |  |
| | Ala-D-gamma-Glu-Lys-D-Ala-D-Ala Chemical Properties |
| Boiling point | 969.733±65.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.283±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | −20°C | | form | Solid | | pka | 3.078±0.10(predicted) | | color | White to off-white | | Sequence | H-Ala-D-γ-Glu-Lys-D-Ala-D-Ala-OH | | InChIKey | MCIBYIIODNXVSL-UHFFFAOYSA-N | | SMILES | CC(N)C(=O)NC(CCC(=O)NC(CCCCN)C(=O)NC(C)C(=O)NC(C)C(O)=O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Ala-D-gamma-Glu-Lys-D-Ala-D-Ala Usage And Synthesis |
| Uses | Ala-D-γ-Glu-Lys-D-Ala-D-Ala is the pentapeptide tail of the peptidoglycan precursor UDPMurNAc-l-Ala-γ-d-Glu-l-Lys(Gly)(5)-d-Ala-d-Ala. Ala-D-γ-Glu-Lys-D-Ala-D-Ala is used to study the role of this peptide stem in peptidoglycan biosynthesis, degradation and function. | | Biological Activity | L-Ala-D-Glu-gamma-L-Lys-D-Ala-D-Ala, peptidoglycan pentapeptide, is the antigenic peptide determinant of peptidoglycan useful in studies of mechanisms of action of glycopeptide antibiotics. |
| | Ala-D-gamma-Glu-Lys-D-Ala-D-Ala Preparation Products And Raw materials |
|