|
|
| | 2-cyanoethyl 3-aminobut-2-enoate Basic information |
| Product Name: | 2-cyanoethyl 3-aminobut-2-enoate | | Synonyms: | 2-cyanoethyl 3-aminobut-2-enoate;2-cyanoethyl β-amino-crotonate;cyanoethyl 3-aminocrotonate;cyanoethyl-3-aminocrotonate;β-cyanoethyl β-aminocrotonate;(Z)-3-Amino-but-2-enoicacid2-cyano-ethyl ester;(2Z)-3-Amino-but-2-enoic acid 2-cyanoethyl ester;2-Cyanoethyl 3-aminocrotonate | | CAS: | 193539-61-6 | | MF: | C7H10N2O2 | | MW: | 154.17 | | EINECS: | | | Product Categories: | | | Mol File: | 193539-61-6.mol |  |
| | 2-cyanoethyl 3-aminobut-2-enoate Chemical Properties |
| Boiling point | 345.6±22.0 °C(Predicted) | | density | 1.116±0.06 g/cm3(Predicted) | | solubility | Dichloromethane; Methanol | | form | Solid | | pka | 5.18±0.70(Predicted) | | color | Beige | | InChI | InChI=1S/C7H10N2O2/c1-6(9)5-7(10)11-4-2-3-8/h5H,2,4,9H2,1H3/b6-5- | | InChIKey | QTKRICXKOUIGOK-WAYWQWQTSA-N | | SMILES | C(OCCC#N)(=O)/C=C(\N)/C |
| | 2-cyanoethyl 3-aminobut-2-enoate Usage And Synthesis |
| Uses | 2-Cyanoethyl 3-aminocrotonate is an intermediate in the synthesis of 3-O-Desethyl-5-O-desmethyl Amlodipine (D291305). 3-O-Desethyl-5-O-desmethyl Amlodipine is an impurity of Amlodipine (A633495), which is a dihydropyridine calcium channel blocker. |
| | 2-cyanoethyl 3-aminobut-2-enoate Preparation Products And Raw materials |
|