| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
|
| | Dapagliflozin Impurity D Basic information |
| Product Name: | Dapagliflozin Impurity D | | Synonyms: | Dapagliflozin Impurity D;(2S,3S,4R,5S,6R)-2-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol;(S)-5-(2,2-dimethyl-4H-benzo[d][1,3]dioxin-6-yl)oxazolidin-2-one;(3R,4S,5S,6R)-2-(4-chloro-3-(2-ethoxybenzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol;Dapagliflozin (C3)-Epimer;D-Mannitol, 1,5-anhydro-1-C-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-, (1S)-;Dapagliflozin C2 Epimer;(2S,3R,4S,5S,6R)-2-(4-chloro-3-(2-ethoxybenzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol | | CAS: | 2133407-75-5 | | MF: | C21H25ClO6 | | MW: | 408.88 | | EINECS: | | | Product Categories: | | | Mol File: | 2133407-75-5.mol |  |
| | Dapagliflozin Impurity D Chemical Properties |
| Melting point | >67°C (dec.) | | Boiling point | 609.0±55.0 °C(Predicted) | | density | 1.349±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.23±0.70(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | JVHXJTBJCFBINQ-TYUQSVNXNA-N | | SMILES | O[C@H]1[C@H]([C@H](O)[C@@H](CO)O[C@H]1C1C=CC(Cl)=C(CC2C=CC(OCC)=CC=2)C=1)O |&1:1,2,3,5,9,r| |
| | Dapagliflozin Impurity D Usage And Synthesis |
| Uses | Dapagliflozin C2 Epimer is an intermediate used in the synthesis of Dapagliflozin (D185370), a sodium-glucose transporter 2 inhibitor. |
| | Dapagliflozin Impurity D Preparation Products And Raw materials |
|