| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
|
| | 2-Methyl-7-trifluoromethylquinolin-4-ol Basic information |
| Product Name: | 2-Methyl-7-trifluoromethylquinolin-4-ol | | Synonyms: | 2-METHYL-7-TRIFLUOROMETHYLQUINOLIN-4(1H)-ONE;2-METHYL-7-TRIFLUOROMETHYL-4(1H)-QUINOLINONE;4-HYDROXY-2-METHYL-7-TRIFLUOROMETHYLQUINOLINE;AKOS BBS-00000361;OTAVA-BB BB7019081214;4-Quinolinol, 2-Methyl-7-(trifluoroMethyl;7-(TrifluoroMethyl)-4-hydroxy-quinilidine;2-Methyl-7-(trifluoromethyl)-4-Quinolinol | | CAS: | 15912-66-0 | | MF: | C11H8F3NO | | MW: | 227.18 | | EINECS: | | | Product Categories: | | | Mol File: | 15912-66-0.mol |  |
| | 2-Methyl-7-trifluoromethylquinolin-4-ol Chemical Properties |
| Boiling point | 316.7±37.0 °C(Predicted) | | density | 1.376±0.06 g/cm3(Predicted) | | pka | 3.93±0.40(Predicted) | | form | solid | | InChI | 1S/C11H8F3NO/c1-6-4-10(16)8-3-2-7(11(12,13)14)5-9(8)15-6/h2-5H,1H3,(H,15,16) | | InChIKey | IIABTAZQWRTZHG-UHFFFAOYSA-N | | SMILES | Cc1cc(O)c2ccc(cc2n1)C(F)(F)F |
| Hazard Codes | T | | Risk Statements | 25-41 | | Safety Statements | 26-39 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1 |
| | 2-Methyl-7-trifluoromethylquinolin-4-ol Usage And Synthesis |
| | 2-Methyl-7-trifluoromethylquinolin-4-ol Preparation Products And Raw materials |
|