| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
Canagliflozin α Isomer manufacturers
|
| | Canagliflozin α Isomer Basic information |
| Product Name: | Canagliflozin α Isomer | | Synonyms: | Canagliflozin α Isomer;Canagliflozin Impurity C;Canagliflozin 1-Epimer;Canagliflozin Impurity 34;Canagliflozin Impurity 34 (Alpha-Isomer);Cagliflozin Impurity 34 (alpha Isomer);Cagliflozin impurity;D-Glucitol, 1,5-anhydro-1-C-[3-[[5-(4-fluorophenyl)-2-thienyl]methyl]-4-methylphenyl]-, (1R)- | | CAS: | 1589590-87-3 | | MF: | C24H25FO5S | | MW: | 444.52 | | EINECS: | | | Product Categories: | Impurities | | Mol File: | 1589590-87-3.mol |  |
| | Canagliflozin α Isomer Chemical Properties |
| Boiling point | 642.9±55.0 °C(Predicted) | | density | 1.364±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 13.34±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | XTNGUQKDFGDXSJ-CMNKHFEDNA-N | | SMILES | O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1C1=CC=C(C)C(CC2SC(C3=CC=C(F)C=C3)=CC=2)=C1 |&1:1,4,6,8,10,r| |
| | Canagliflozin α Isomer Usage And Synthesis |
| Uses | epi-Canagliflozin is an epimeric impurity of Canagliflozin which is a sodium/glucose cotransporter 2 (SGLT2) inhibitor and is used in the treatment of type 2 diabetes and obesity. |
| | Canagliflozin α Isomer Preparation Products And Raw materials |
|