| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- ZINC NEODECANOATE
-
-
2026-06-30
- CAS:27253-29-8
- Min. Order: 1KG
- Purity: 98
- Supply Ability: 10000KGS
- ZINC NEODECANOATE
-
- $45.00
-
2025-05-23
- CAS:27253-29-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 tons
- ZINC NEODECANOATE
-
- $8.00
-
2025-02-13
- CAS:27253-29-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 tons
|
| | ZINC NEODECANOATE Basic information |
| Product Name: | ZINC NEODECANOATE | | Synonyms: | ZINC NEODECANOATE;Neodecanoicacid,zincsalt;Zincneodecanoateinmineralspirits;Zinc neodecanoate, 40% in mineral spirits;Zinkneodecanoat;Zinc neodecanoate, Zn 17.9-18.2%;Zinc neodecanoate, Zn;ZINC NEODECANOATE, tech-95 | | CAS: | 27253-29-8 | | MF: | C20H38O4Zn | | MW: | 407.9 | | EINECS: | 248-370-4 | | Product Categories: | Organic-metal salt;1 | | Mol File: | 27253-29-8.mol |  |
| | ZINC NEODECANOATE Chemical Properties |
| Fp | 102°C | | storage temp. | Storage temp. 2-8°C | | form | Liquid | | Specific Gravity | 1.10 | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Immiscible with water. | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Cosmetics Ingredients Functions | ANTICAKING OPACIFYING VISCOSITY CONTROLLING | | InChI | InChI=1S/2C10H20O2.Zn/c2*1-10(2,3)8-6-4-5-7-9(11)12;/h2*4-8H2,1-3H3,(H,11,12);/q;;+2/p-2 | | InChIKey | LFOXXKXKYHIANI-UHFFFAOYSA-L | | SMILES | C(C)(C)(C)CCCCCC(=O)O[Zn]OC(=O)CCCCCC(C)(C)C | | LogP | 3.234 (est) | | CAS DataBase Reference | 27253-29-8 | | EPA Substance Registry System | Zinc neodecanoate (27253-29-8) |
| Provider | Language |
|
ALFA
| English |
| | ZINC NEODECANOATE Usage And Synthesis |
| Uses | PU catalysts | | Uses | Zinc neodecanoate is used as a catalyst, lubricant additive and drier. Further it is used in the production of rubber and plastic products. In addition it serves as a polyurethane catalyst. | | Flammability and Explosibility | Non flammable |
| | ZINC NEODECANOATE Preparation Products And Raw materials |
|