| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
2,2'-Dibromooctafluorobiphenyl 97% manufacturers
|
| | 2,2'-Dibromooctafluorobiphenyl 97% Basic information |
| Product Name: | 2,2'-Dibromooctafluorobiphenyl 97% | | Synonyms: | 2,2'-Dibromooctafluorobiphenyl 97%;1,1'-Biphenyl, 2,2'-dibromo-3,3',4,4',5,5',6,6'-octafluoro-;-Dibromooctafluorobiphenyl;2,2'-Dibromo-3,3',4,4',5,5',6,6'-octafluoro-1,1'-biphenyl;2,2'-Dibromooctafluorobiphenyl 97% | | CAS: | 5576-19-2 | | MF: | C12Br2F8 | | MW: | 455.92 | | EINECS: | | | Product Categories: | | | Mol File: | 5576-19-2.mol |  |
| | 2,2'-Dibromooctafluorobiphenyl 97% Chemical Properties |
| Melting point | 95-100°C | | Boiling point | 285.0±35.0 °C(Predicted) | | density | 2.065±0.06 g/cm3(Predicted) | | form | crystals | | InChI | 1S/C12Br2F8/c13-3-1(5(15)9(19)11(21)7(3)17)2-4(14)8(18)12(22)10(20)6(2)16 | | InChIKey | CZEFBGCEVOAASZ-UHFFFAOYSA-N | | SMILES | FC1=C(F)C(C2=C(F)C(F)=C(F)C(F)=C2Br)=C(Br)C(F)=C1F |
| RIDADR | UN 3152PSN1 9 / PGII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2'-Dibromooctafluorobiphenyl 97% Usage And Synthesis |
| Uses | This material is a precursor in the synthesis of Donor-Acceptor systems useful for use as electron transporting materials in blends with P3HT in organic photovoltaic devices. |
| | 2,2'-Dibromooctafluorobiphenyl 97% Preparation Products And Raw materials |
|