1,2-Dibromotetrafluorobenzene manufacturers
|
| | 1,2-Dibromotetrafluorobenzene Basic information |
| Product Name: | 1,2-Dibromotetrafluorobenzene | | Synonyms: | 1,2-Dibromoperfluorobenzene;4-fluroethyl benzoate;Benzene, 1,2-dibromotetrafluoro-;TETRAFLUORO-1,2-DIBROMOBENZENE;1,2-DIBROMOTETRAFLUOROBENZENE;1,2-Dibromotetrafluorobenzene 99%;1,2-Dibromotetrafluorobenzene99%;Benzene,1,2-dibromo-3,4,5,6-tetrafluoro- | | CAS: | 827-08-7 | | MF: | C6Br2F4 | | MW: | 307.87 | | EINECS: | 212-564-7 | | Product Categories: | Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 827-08-7.mol |  |
| | 1,2-Dibromotetrafluorobenzene Chemical Properties |
| Melting point | 12°C | | Boiling point | 198 °C (lit.) | | density | 2.238 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.516(lit.) | | Fp | 210 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless | | Specific Gravity | 2.238 | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C6Br2F4/c7-1-2(8)4(10)6(12)5(11)3(1)9 | | InChIKey | IPLUWQPTPKNBRD-UHFFFAOYSA-N | | SMILES | C1(Br)=C(F)C(F)=C(F)C(F)=C1Br | | CAS DataBase Reference | 827-08-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1,2-dibromo-3,4,5,6-tetrafluoro-(827-08-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29036990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2-Dibromotetrafluorobenzene Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1,2-Dibromotetrafluorobenzene is used as medicine and liquid crystal material intermediate. It helps in the synthesis of diphenyl(o-bromotetrafluorophenyl)phosphine and 2,3,4,5tetrafluorothioanisole. |
| | 1,2-Dibromotetrafluorobenzene Preparation Products And Raw materials |
| Preparation Products | 3,4,5,6-Tetrafluorophthalonitrile-->2,3,4,5-Tetrafluorobenzaldehyde-->1-BROMO-2,3,4,5-TETRAFLUOROBENZENE-->2-Bromo-3,4,5,6-tetrafluorotoluene-->Triphenylene, 1,2,3,4,5,6,7,8,9,10,11,12-dodecafluoro--->2,2'-Dibromooctafluorobiphenyl 97% |
|