- 3-Aminophenylurea
-
- $1.00
-
2020-02-06
- CAS:25711-72-2
- Min. Order: 1KG
- Purity: 99%HPLC
- Supply Ability: 100KG
|
| | 3-Aminophenylurea Basic information |
| | 3-Aminophenylurea Chemical Properties |
| Boiling point | 321.0±25.0 °C(Predicted) | | density | 1.350±0.06 g/cm3(Predicted) | | vapor pressure | 0.004Pa at 25℃ | | storage temp. | 2-8°C(protect from light) | | pka | 14.59±0.50(Predicted) | | Water Solubility | 16.38g/L at 25℃ | | InChI | InChI=1S/C7H9N3O/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,8H2,(H3,9,10,11) | | InChIKey | ZNXSFVXZQBETRJ-UHFFFAOYSA-N | | SMILES | N(C1=CC=CC(N)=C1)C(N)=O | | LogP | -0.76 | | EPA Substance Registry System | Urea, (3-aminophenyl)- (25711-72-2) |
| | 3-Aminophenylurea Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | 3-Aminophenylurea Preparation Products And Raw materials |
|