|
|
| | (R)-((2R,5S)-5-(4-aminobenzyl)pyrrolidin-2-yl)(phenyl)methanol Basic information |
| | (R)-((2R,5S)-5-(4-aminobenzyl)pyrrolidin-2-yl)(phenyl)methanol Chemical Properties |
| Boiling point | 467.2±14.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | pka | 13.96±0.20(Predicted) | | InChI | InChI=1S/C18H22N2O/c19-15-8-6-13(7-9-15)12-16-10-11-17(20-16)18(21)14-4-2-1-3-5-14/h1-9,16-18,20-21H,10-12,19H2/t16-,17+,18+/m0/s1 | | InChIKey | CBVGYKIYIAYXTO-RCCFBDPRSA-N | | SMILES | [C@H]([C@H]1CC[C@@H](CC2=CC=C(N)C=C2)N1)(C1=CC=CC=C1)O |
| | (R)-((2R,5S)-5-(4-aminobenzyl)pyrrolidin-2-yl)(phenyl)methanol Usage And Synthesis |
| Uses | (R)-((2R,5S)-5-(4-aminobenzyl)pyrrolidin-2-yl)(phenyl)methanol is a pharmaceutical impurity that is a byproduct of the production process of vibergolone. Vibergolone is a dopaminergic drug used to treat high levels of prolactin in the blood. |
| | (R)-((2R,5S)-5-(4-aminobenzyl)pyrrolidin-2-yl)(phenyl)methanol Preparation Products And Raw materials |
|