|
|
| | (2-Methoxyphenyl)-carbamic acid, 1,1-dimethyl ethyl ester Basic information |
| Product Name: | (2-Methoxyphenyl)-carbamic acid, 1,1-dimethyl ethyl ester | | Synonyms: | TERT-BUTYL 2-METHOXYPHENYLCARBAMATE;tert-Butyl N-(2-methoxyphenyl)carbamate;2-Methoxyaniline, N-BOC protected;tert-Butyl (2-methoxyphenyl)carbamate, 2-[(tert-Butoxycarbonyl)amino]anisole, N-(tert-Butoxycarbonyl)-2-methoxyaniline;N-(2-Methoxyphenyl)-carbaMic acid 1,1-diMethylethyl Ester;1-(Boc-amino)-2-methoxybenzene;Boc-o-anisidine;N -(2-Methoxyphenyl)carbamic acid tert-butyl ester | | CAS: | 154150-18-2 | | MF: | C12H17NO3 | | MW: | 223.27 | | EINECS: | 803-043-0 | | Product Categories: | | | Mol File: | 154150-18-2.mol |  |
| | (2-Methoxyphenyl)-carbamic acid, 1,1-dimethyl ethyl ester Chemical Properties |
| Melting point | 33.5-35.0°C | | Fp | >110℃ | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | Appearance | White to off-white <33.5°C Solid,>35.0°C Liquid | | InChI | 1S/C12H17NO3/c1-12(2,3)16-11(14)13-9-7-5-6-8-10(9)15-4/h5-8H,1-4H3,(H,13,14) | | InChIKey | DHSWMVURURVRDB-UHFFFAOYSA-N | | SMILES | COc1ccccc1NC(=O)OC(C)(C)C |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (2-Methoxyphenyl)-carbamic acid, 1,1-dimethyl ethyl ester Usage And Synthesis |
| | (2-Methoxyphenyl)-carbamic acid, 1,1-dimethyl ethyl ester Preparation Products And Raw materials |
|