|
|
| | tert-butyl 4-bromo-3-chlorophenylcarbamate Basic information |
| Product Name: | tert-butyl 4-bromo-3-chlorophenylcarbamate | | Synonyms: | tert-butyl 4-bromo-3-chlorophenylcarbamate;RMEYTKODWQFCLB-UHFFFAOYSA-N;tert-Butyl n-(4-bromo-3-chlorophenyl)carbamate;Carbamic acid, N-(4-bromo-3-chlorophenyl)-, 1,1-dimethylethyl ester;(4-bromo-3-chlorophenyl)carbamate tert-butyl ester | | CAS: | 1092493-67-8 | | MF: | C11H13BrClNO2 | | MW: | 306.58 | | EINECS: | | | Product Categories: | | | Mol File: | 1092493-67-8.mol |  |
| | tert-butyl 4-bromo-3-chlorophenylcarbamate Chemical Properties |
| storage temp. | Store at room temperature | | Appearance | White to off-white Solid |
| | tert-butyl 4-bromo-3-chlorophenylcarbamate Usage And Synthesis |
| | tert-butyl 4-bromo-3-chlorophenylcarbamate Preparation Products And Raw materials |
|