|
|
| | Ac-Gln-Lys-Leu-Val-Phe-Phe-NH2 Basic information |
| Product Name: | Ac-Gln-Lys-Leu-Val-Phe-Phe-NH2 | | Synonyms: | BETA-AMYLOID LIGAND;AMYLOID BETA-PROTEIN ACETYL-FRAGMENT 15-20 AMIDE;AC-QKLVFF;AC-AMYLOID BETA-PROTEIN (15-20) AMIDE;ACETYL-BETA-AMYLOID (15-20);ACETYL-AMYLOID BETA-PROTEIN (15-20) AMIDE;AC-GLN-LYS-LEU-VAL-PHE-PHE-OH;acetyl-amyloid B protein fragment 15-20 amide | | CAS: | 189064-06-0 | | MF: | C42H63N9O8 | | MW: | 822.01 | | EINECS: | | | Product Categories: | peptide | | Mol File: | 189064-06-0.mol |  |
| | Ac-Gln-Lys-Leu-Val-Phe-Phe-NH2 Chemical Properties |
| Boiling point | 1250.0±65.0 °C(Predicted) | | density | 1.192±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | form | powder | | pka | 13.33±0.46(Predicted) | | color | white | | Sequence | Ac-Gln-Lys-Leu-Val-Phe-Phe-NH2 | | InChIKey | DDXTVYDSGCHGAN-PITCCTKHSA-N | | SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(C)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc2ccccc2)C(N)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Ac-Gln-Lys-Leu-Val-Phe-Phe-NH2 Usage And Synthesis |
| Uses | Acetly-β Amyloid (15-20), Amide is a peptides fragment. Acetly-β Amyloid (15-20), Amide inhibits the β-sheet formation and stabilizes structure of Aβ (1–40) peptide. Acetly-β Amyloid (15-20), Amide can be used in study Alzheimer’s disease[1]. | | Biological Activity | Amyloid plaques characteristic of the Alzheimer brain contain fibrils composed of amyloid beta aggregates. Short peptides containing the sequence KLVFF have been shown to bind specifically to the homologous region in Aβ and are used to prevent full length amyloid fibril formation. | | References | [1] Lin SY, et al. Fourier transform infrared spectroscopy used to evidence the prevention of beta-sheet formation of amyloid beta(1-40) peptide by a short amyloid fragment. Int J Biol Macromol. 2003 Sep;32(3-5):173-7. DOI:10.1016/s0141-8130(03)00051-5 |
| | Ac-Gln-Lys-Leu-Val-Phe-Phe-NH2 Preparation Products And Raw materials |
|