|
|
| | 4-Chloro-5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidine Basic information |
| | 4-Chloro-5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidine Chemical Properties |
| Boiling point | 432.4±45.0 °C(Predicted) | | density | 1.313±0.06 g/cm3(Predicted) | | pka | 0.40±0.40(Predicted) | | form | solid | | InChI | 1S/C14H11ClN2S/c1-8-3-4-10(5-9(8)2)11-6-18-14-12(11)13(15)16-7-17-14/h3-7H,1-2H3 | | InChIKey | YHGOZPYHUNWJBE-UHFFFAOYSA-N | | SMILES | ClC1=NC=NC2=C1C(C(C=C3C)=CC=C3C)=CS2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 |
| | 4-Chloro-5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidine Usage And Synthesis |
| | 4-Chloro-5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidine Preparation Products And Raw materials |
|