| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine Basic information |
| | 4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine Chemical Properties |
| Melting point | 139.5-141℃ | | Boiling point | 443.1±45.0 °C(Predicted) | | density | 1.490±0.06 g/cm3(Predicted) | | form | solid | | pka | 0.10±0.40(Predicted) | | InChI | 1S/C12H6Cl2N2S/c13-8-3-1-7(2-4-8)9-5-17-12-10(9)11(14)15-6-16-12/h1-6H | | InChIKey | QDMQHIKVIOWCGY-UHFFFAOYSA-N | | SMILES | ClC1=NC=NC2=C1C(C(C=C3)=CC=C3Cl)=CS2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 |
| | 4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine Usage And Synthesis |
| | 4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine Preparation Products And Raw materials |
|