| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | BS2G Crosslinker Basic information |
| Product Name: | BS2G Crosslinker | | Synonyms: | JINCQYPCQMBZSX-UHFFFAOYSA-L;BS2G;CAS_881415-72-1;BS2G Crosslinker disodium;Bis(3-sulfo-N-succinimidyl) Glutarate Disodium Salt;1,5-Bis(2,5-dioxo-3-sulfo-1-pyrrolidinyl) Pentanedioate Sodium Salt;Glutaric Acid Bis(3-sulfo-N-succinimidyl) Disodium Salt;Pentanedioic Acid 1,5-Bis(2,5-dioxo-3-sulfo-1-pyrrolidinyl) Ester Sodium Salt | | CAS: | 881415-72-1 | | MF: | C13H12N2O14S2.2Na | | MW: | 510.37 | | EINECS: | | | Product Categories: | | | Mol File: | 881415-72-1.mol |  |
| | BS2G Crosslinker Chemical Properties |
| solubility | DMSO : 125 mg/mL (235.69 mM; Need ultrasonic) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C13H14N2O14S2.Na.H/c16-8-4-6(30(22,23)24)12(20)14(8)28-10(18)2-1-3-11(19)29-15-9(17)5-7(13(15)21)31(25,26)27;;/h6-7H,1-5H2,(H,22,23,24)(H,25,26,27);; | | InChIKey | PLZZCIWTCCHFLV-UHFFFAOYSA-N | | SMILES | O(N1C(CC(S(O)(=O)=O)C1=O)=O)C(=O)CCCC(=O)ON1C(CC(S(O)(=O)=O)C1=O)=O.[NaH] |
| | BS2G Crosslinker Usage And Synthesis |
| Uses | Glutaric Acid Bis(3-Sulfo-N-hydroxysuccinimide Ester) Disodium Salt is a water soluble and cell membrane impermeable crosslinking agent. Glutaric Acid Bis(3-Sulfo-N-hydroxysuccinimide Ester) was used in studies of insulin crosslinking to insulin receptors. | | IC 50 | Non-cleavable Linker |
| | BS2G Crosslinker Preparation Products And Raw materials |
|