|
|
| | 1,4-Dibromobutane-2,2,3,3-d4 Basic information |
| Product Name: | 1,4-Dibromobutane-2,2,3,3-d4 | | Synonyms: | 1 4-DIBROMOBUTANE-2 2 3 3-D4 98 ATOM %&;1,4-Dibromobutane-2,2,3,3-d4;1,4-Dibromobutane-2,2,3,3-d4 | | CAS: | 52089-63-1 | | MF: | C4H4Br2D4 | | MW: | 219.94 | | EINECS: | | | Product Categories: | Alphabetical Listings;D;Stable Isotopes | | Mol File: | 52089-63-1.mol |  |
| | 1,4-Dibromobutane-2,2,3,3-d4 Chemical Properties |
| Melting point | −20 °C(lit.) | | Boiling point | 63-65 °C/6 mmHg(lit.) | | density | 1.908 g/mL at 25 °C | | refractive index | n20/D 1.5186(lit.) | | InChI | 1S/C4H8Br2/c5-3-1-2-4-6/h1-4H2/i1D2,2D2 | | InChIKey | ULTHEAFYOOPTTB-LNLMKGTHSA-N | | SMILES | [2H]C([2H])(CBr)C([2H])([2H])CBr |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-41-37/38-25 | | Safety Statements | 26-36-45-39 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | WGK 2 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Irrit. 2
Skin Irrit. 2 |
| | 1,4-Dibromobutane-2,2,3,3-d4 Usage And Synthesis |
| Uses | 1,4-Dibromobutane-2,2,3,3-d4 (CAS# 52089-63-1) is a useful isotopically labeled research compound. |
| | 1,4-Dibromobutane-2,2,3,3-d4 Preparation Products And Raw materials |
|