|
|
| | Nickel 2-ethylhexanoate Basic information |
| Product Name: | Nickel 2-ethylhexanoate | | Synonyms: | NICKEL(II) 2-ETHYLHEXANOATE;(2-ethylhexanoato-O)(isooctanoato-O)nickel;NICKEL(II) 2-ETHYLHEXANOATE TOLUENE SOLUTION (NI : 6%);Einecs 284-350-1;2-ETHYLHEXANOIC ACID, NICKEL(II) SALT;Nickel 2-ethylhexanoate | | CAS: | 84852-38-0 | | MF: | C16H30NiO4 | | MW: | 345.1 | | EINECS: | 284-350-1 | | Product Categories: | | | Mol File: | 84852-38-0.mol |  |
| | Nickel 2-ethylhexanoate Chemical Properties |
| density | 0.96 g/mL at 25 °C(lit.) | | Fp | >230 °F | | form | semisolid
viscous liquid | | InChI | 1S/2C8H16O2.Ni/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 | | InChIKey | UVPKUTPZWFHAHY-UHFFFAOYSA-L | | SMILES | CCCCC(CC)C(=O)O[Ni]OC(=O)C(CC)CCCC |
| Hazard Codes | T | | Risk Statements | 45-20/21/22-36/37/38 | | Safety Statements | 53-26-36/37/39-45 | | RIDADR | UN3082 - class 9 - PG 3 - DOT NA1993 - Environmentally hazardous substances, liquid, n.o.s. HI: all (not BR) | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 1A
Muta. 2
Repr. 1B
Resp. Sens. 1
Skin Sens. 1
STOT RE 1 |
| | Nickel 2-ethylhexanoate Usage And Synthesis |
| reaction suitability | core: nickel |
| | Nickel 2-ethylhexanoate Preparation Products And Raw materials |
|