NICKEL 2-ETHYLHEXANOATE manufacturers
|
| | NICKEL 2-ETHYLHEXANOATE Basic information |
| Product Name: | NICKEL 2-ETHYLHEXANOATE | | Synonyms: | Nickel(II) 2-ethylhexanoate Liquid;2-ethyl-hexanoicacinickel(2++)salt;NICKEL(II) 2-ETHYLHEXANOATE;NICKEL 2-ETHYLHEXANOATE;2-ETHYLHEXANOIC ACID, NICKEL(II) SALT;Nickelethylhexanoateinethylhexanoicacid;nickel bis(2-ethylhexanoate);Nickelous 2-ethylhexanoate | | CAS: | 4454-16-4 | | MF: | C8H16NiO2 | | MW: | 202.91 | | EINECS: | 224-699-9 | | Product Categories: | metal carboxylate;Organic-metal salt | | Mol File: | 4454-16-4.mol |  |
| | NICKEL 2-ETHYLHEXANOATE Chemical Properties |
| Boiling point | 327.2℃[at 101 325 Pa] | | density | 0.96 g/mL at 25 °C (lit.) | | vapor pressure | 0Pa at 25℃ | | Fp | >230 °F | | solubility | sol toluene, xylenes; slightly sol hexane. | | form | liquid | | Specific Gravity | 1.08 | | Water Solubility | 110mg/L at 30℃ | | InChI | InChI=1S/C8H16O2.Ni/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10); | | InChIKey | XRBQEYWBWZFUIJ-UHFFFAOYSA-N | | SMILES | C(CC)(C(=O)O)CCCC.[Ni] | | LogP | -0.33 | | EPA Substance Registry System | Hexanoic acid, 2-ethyl-, nickel(2+) salt (4454-16-4) |
| | NICKEL 2-ETHYLHEXANOATE Usage And Synthesis |
| Uses | Petrochemical catalyst, Rubber manufacturing | | Application | Nickel 2-ethylhexanoate is a catalyst that can be used in combination with bromine for the regioselective oxidation of diols and for the conversion of diols to lactones. | | storage | Not hygroscopic; nickel compounds are cancer suspect agents. |
| | NICKEL 2-ETHYLHEXANOATE Preparation Products And Raw materials |
|