|
|
| | Tributyl(phenylethenyl)tin Basic information |
| Product Name: | Tributyl(phenylethenyl)tin | | Synonyms: | TRIBUTYLTIN-A-STYRENE;Stannane,tributyl(2-phenylethenyl)-;Tributyl(phenylethenyl)tin - [T5617];Tributyl(phenylethenyl)tin | | CAS: | 79159-76-5 | | MF: | C20H34Sn | | MW: | 393.19 | | EINECS: | | | Product Categories: | | | Mol File: | 79159-76-5.mol |  |
| | Tributyl(phenylethenyl)tin Chemical Properties |
| Boiling point | 404.7±38.0 °C(Predicted) | | form | solid | | InChI | 1S/C8H7.3C4H9.Sn/c1-2-8-6-4-3-5-7-8;3*1-3-4-2;/h1-7H;3*1,3-4H2,2H3; | | InChIKey | SENXCDRAXNPDOK-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)/C=C/C1=CC=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | Tributyl(phenylethenyl)tin Usage And Synthesis |
| | Tributyl(phenylethenyl)tin Preparation Products And Raw materials |
|