|
|
| | D-Alanine-3,3,3-d3 Basic information |
| Product Name: | D-Alanine-3,3,3-d3 | | Synonyms: | D-Alanine-d3;[2H3]-D-Alanine;(2R)-2-amino-3,3,3-trideuterio-propanoic acid;D-Alanine-3,3,3-d3;D-Alanine-3,3,3-D3 (Standard);D-Alanine-3,3,3-d3 | | CAS: | 177614-69-6 | | MF: | C3H4D3NO2 | | MW: | 92.11 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N;Stable Isotopes;AStable Isotopes;Amino Acids;Alphabetical Listings | | Mol File: | 177614-69-6.mol |  |
| | D-Alanine-3,3,3-d3 Chemical Properties |
| Melting point | 291 °C (dec.)(lit.) | | Boiling point | 212.907±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.161±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Refrigerator | | solubility | Aqueous Acid (Slightly), Aqueous Base (Slightly), Water (Sparingly, Sonicated) | | pka | 2.308±0.10(predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D -14.5°, c = 2 in 1 M HCl | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | InChI | 1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m1/s1/i1D3 | | InChIKey | QNAYBMKLOCPYGJ-HBXZPZNNSA-N | | SMILES | [2H]C([2H])([2H])[C@@H](N)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-Alanine-3,3,3-d3 Usage And Synthesis |
| Uses | D-Alanine-3,3,3-d3 is a labelled form of D-Alanine (A480995) which is an amino acid that is commonly found in bacteria, such as Streptococcus faecalis. It is essential for the biosynthesis of peptidoglycan crosslinking sub-units that are used for bacterial cell walls. D-Alanine is also known to cause cytotoxic oxidative stress in brain tumour cells. |
| | D-Alanine-3,3,3-d3 Preparation Products And Raw materials |
|