|
|
| | BOC-L-4,4'-BIPHENYLALANINE Basic information |
| | BOC-L-4,4'-BIPHENYLALANINE Chemical Properties |
| Melting point | 103-107 °C(lit.) | | Boiling point | 528.2±50.0 °C(Predicted) | | density | 1.161±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 3.88±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]22/D +21°, c = 2 in methanol | | Major Application | peptide synthesis | | InChI | 1S/C20H23NO4/c1-20(2,3)25-19(24)21-17(18(22)23)13-14-9-11-16(12-10-14)15-7-5-4-6-8-15/h4-12,17H,13H2,1-3H3,(H,21,24)(H,22,23)/t17-/m0/s1 | | InChIKey | NBVVKAUSAGHTSU-KRWDZBQOSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(cc1)-c2ccccc2)C(O)=O | | CAS DataBase Reference | 147923-08-8(CAS DataBase Reference) |
| | BOC-L-4,4'-BIPHENYLALANINE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Boc-4-phenyl-L-phenylalanine is a reactant used in the synthesis of novel phenylalanines derived diamides as factor XIa inhibitors used in the treatment. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-4,4'-BIPHENYLALANINE Preparation Products And Raw materials |
|