|
|
| | 4-[3-(Trifluoromethyl)phenoxy]piperidine Basic information |
| | 4-[3-(Trifluoromethyl)phenoxy]piperidine Chemical Properties |
| Boiling point | 290.7±40.0 °C(Predicted) | | density | 1.193±0.06 g/cm3(Predicted) | | pka | 9.69±0.10(Predicted) | | form | solid | | InChI | 1S/C12H14F3NO/c13-12(14,15)9-2-1-3-11(8-9)17-10-4-6-16-7-5-10/h1-3,8,10,16H,4-7H2 | | InChIKey | BYJVBLFZMKBFMT-UHFFFAOYSA-N | | SMILES | FC(F)(F)C1=CC(OC2CCNCC2)=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-[3-(Trifluoromethyl)phenoxy]piperidine Usage And Synthesis |
| | 4-[3-(Trifluoromethyl)phenoxy]piperidine Preparation Products And Raw materials |
|