|
|
| | 2,6-DIHYDROXYANTHRAQUINONE Basic information |
| Product Name: | 2,6-DIHYDROXYANTHRAQUINONE | | Synonyms: | 2,6-Dihydroxy-9,10-anthraquinone;Anthraflavic acid technical grade, 90%;9,10-Anthracenedione, 2,6-dihydroxy-;2,6-dihydroxy-10-anthracenedione;10-Anthracenedione,2,6-dihydroxy-9;Anthrafravic acid;Anthraflavic acid,2,6-Dihydroxyanthraquinone, Anthraflavine;2,6-Dihydroxyanthraquinone, 94% 5GR | | CAS: | 84-60-6 | | MF: | C14H8O4 | | MW: | 240.21 | | EINECS: | 201-544-3 | | Product Categories: | Building Blocks;C13 to C14;Carbonyl Compounds;Chemical Synthesis;Ketones;Organic Building Blocks;Anthraquinones, Hydroquinones and Quinones;Anthraquinones;Highly Purified Reagents;Hydroxyanthraquinones;Other Categories;Refined Products by Sublimation | | Mol File: | 84-60-6.mol |  |
| | 2,6-DIHYDROXYANTHRAQUINONE Chemical Properties |
| Melting point | >320 °C(lit.) | | Boiling point | 342.92°C (rough estimate) | | density | 1.3032 (rough estimate) | | refractive index | 1.5430 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in DMSO | | form | powder to crystal | | pka | 6.72±0.20(Predicted) | | color | Light yellow to Brown to Dark green | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H | | InChIKey | APAJFZPFBHMFQR-UHFFFAOYSA-N | | SMILES | Oc1ccc2C(=O)c3cc(O)ccc3C(=O)c2c1 | | LogP | 3.360 (est) | | CAS DataBase Reference | 84-60-6(CAS DataBase Reference) | | EPA Substance Registry System | 9,10-Anthracenedione, 2,6-dihydroxy- (84-60-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36/37 | | WGK Germany | 3 | | RTECS | CB6675000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29146990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-DIHYDROXYANTHRAQUINONE Usage And Synthesis |
| Chemical Properties | solid | | Uses | Anthraflavic acid can be used as a starting material to synthesize tetrahydroxy tetrathiafulvalene (TTF) derivatives, which are used as redox-active building blocks in supramolecular and materials science. It is also utilized to prepare phosphanylidene anthra[2,1-b]furans by reacting with dialkyl acetylenedicarboxylates and triphenylphosphine. | | Definition | ChEBI: A dihydroxyanthraquinone that is anthracene substituted by hydroxy groups at C-3 and C-7 and oxo groups at C-9 and C-10. |
| | 2,6-DIHYDROXYANTHRAQUINONE Preparation Products And Raw materials |
|