| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
|
| | 4-Chloro-6-methoxy-2-methylquinoline Basic information |
| Product Name: | 4-Chloro-6-methoxy-2-methylquinoline | | Synonyms: | TIMTEC-BB SBB010126;4-CHLORO-6-METHOXYQUINALDINE;6-Methoxy-4-chloro-2-methylquinoline;6-Methoxy-4-chloroquinalidine;6-Methoxy-4-chloro quinilidine;4-Chloro-6-methoxy-2-methyl-1-azanaphthalene;4-Chloro-6-Methoxy-2-Methylquinoline
4-Chloro-6-Methoxy-2-Methyl-Quinoline;Qu071 | | CAS: | 50593-73-2 | | MF: | C11H10ClNO | | MW: | 207.66 | | EINECS: | | | Product Categories: | | | Mol File: | 50593-73-2.mol |  |
| | 4-Chloro-6-methoxy-2-methylquinoline Chemical Properties |
| Melting point | 92-93 °C(Solv: ethanol (64-17-5)) | | Boiling point | 308.8±37.0 °C(Predicted) | | density | 1.228±0.06 g/cm3(Predicted) | | pka | 4.41±0.50(Predicted) | | form | powder | | color | Light purple | | InChI | 1S/C11H10ClNO/c1-7-5-10(12)9-6-8(14-2)3-4-11(9)13-7/h3-6H,1-2H3 | | InChIKey | WABDZSKKLDCIRM-UHFFFAOYSA-N | | SMILES | ClC1=CC(C)=NC(C=C2)=C1C=C2OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41 | | Safety Statements | 26-36/37/39-39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1 |
| | 4-Chloro-6-methoxy-2-methylquinoline Usage And Synthesis |
| Uses | 4-Chloro-6-methoxy-2-methylquinoline can be useful in the preparation and stuyd of antitubercular activity, SAR and lipophilicity of ((benzyloxy)benzylamino)alkylquinolines. |
| | 4-Chloro-6-methoxy-2-methylquinoline Preparation Products And Raw materials |
|