|
|
| | Ethyl 2,4-dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate Basic information |
| | Ethyl 2,4-dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate Chemical Properties |
| Melting point | 75-77 °C(lit.) | | Boiling point | 165-170 °C(Press: 0.02 Torr) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | chunks | | pka | 16.40±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C14H21NO4/c1-5-18-12(16)8-7-11-9(3)13(15-10(11)4)14(17)19-6-2/h15H,5-8H2,1-4H3 | | InChIKey | ZYNJVGCLOFPWFZ-UHFFFAOYSA-N | | SMILES | CCOC(=O)CCc1c(C)[nH]c(C(=O)OCC)c1C | | CAS DataBase Reference | 54278-10-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethyl 2,4-dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate Usage And Synthesis |
| Chemical Properties | White or white crystalline | | Uses | Ethyl 2,4-dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate may be used in chemical synthesis studies. |
| | Ethyl 2,4-dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate Preparation Products And Raw materials |
|