5-[(Dimethylamino)methyl]-2-furanmethanol manufacturers
|
| | 5-[(Dimethylamino)methyl]-2-furanmethanol Basic information |
| Product Name: | 5-[(Dimethylamino)methyl]-2-furanmethanol | | Synonyms: | Ranitidine Impurity F HCl;5-[(dimethylamino)methyl]furan-2-methanol;5-Dimethylaminomethyl-2-furfuryl alcohol;Einecs 239-445-2;2-FuranMethanol, 5-[(diMethylaMino)Methyl]-;(5-((dimethylamino)methyl)furan-2-yl)methanol? (Ranitidine Impurity);(5-((diMethylaMino)Methyl)furan-2-yl)Methanol;5-[(Dimethylamino)methyl]-2-furanmethanol | | CAS: | 15433-79-1 | | MF: | C8H13NO2 | | MW: | 155.19 | | EINECS: | 239-445-2 | | Product Categories: | | | Mol File: | 15433-79-1.mol | ![5-[(Dimethylamino)methyl]-2-furanmethanol Structure](CAS/GIF/15433-79-1.gif) |
| | 5-[(Dimethylamino)methyl]-2-furanmethanol Chemical Properties |
| Boiling point | 110-111 °C(Press: 3 Torr) | | density | 1.07 g/cm3(Temp: 25 °C) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | pka | 14.02±0.10(Predicted) | | color | Dark Beige to Very Dark Brown | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H13NO2/c1-9(2)5-7-3-4-8(6-10)11-7/h3-4,10H,5-6H2,1-2H3 | | InChIKey | BQRQOLQFLNSWNV-UHFFFAOYSA-N | | SMILES | O1C(CN(C)C)=CC=C1CO |
| | 5-[(Dimethylamino)methyl]-2-furanmethanol Usage And Synthesis |
| Uses | 5-[(Dimethylamino)methyl]-2-furanmethanol is an intermediate in the synthesis of Ranitidine hydrochloride (R120000). 5-[(Dimethylamino)methyl]-2-furanmethanol is an inhibitor of monoamine oxidase B. |
| | 5-[(Dimethylamino)methyl]-2-furanmethanol Preparation Products And Raw materials |
|