| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5BETA-CHOLESTAN-3ALPHA-OL Basic information |
| Product Name: | 5BETA-CHOLESTAN-3ALPHA-OL | | Synonyms: | (3R,5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol;(3R,5R,8R,9S,10S,13R,14S,17R)-17-[(1R)-1,5-dimethylhexyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol;5β-Cholestan-3α-ol,Epicoprostanol;(3R,5R,8R,9S,10S,13R,14S,17R)-10,13-diMethyl-17-((R)-6-Methylheptan-2-yl)hexadecahydro-1H-cyclopenta[a]phenanthren-3-ol;5BETA-CHOLESTAN-3A-OL;5BETA-CHOLESTAN-3ALPHA-OL;EPICOPROSTEROL;COPROSTAN-3A-OL | | CAS: | 516-92-7 | | MF: | C27H48O | | MW: | 388.67 | | EINECS: | | | Product Categories: | | | Mol File: | 516-92-7.mol |  |
| | 5BETA-CHOLESTAN-3ALPHA-OL Chemical Properties |
| Melting point | 115 °C(Solv: methanol (67-56-1)) | | Boiling point | 455.5±13.0 °C(Predicted) | | density | 0.956±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 15.14±0.70(Predicted) | | form | powder | | Optical Rotation | +3125 (C6H6) | | InChIKey | QYIXCDOBOSTCEI-KKFSNPNRSA-N | | SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| WGK Germany | 3 | | HS Code | 2906130000 | | Storage Class | 11 - Combustible Solids |
| | 5BETA-CHOLESTAN-3ALPHA-OL Usage And Synthesis |
| Uses | 5β-Cholestan-3α-ol was used as internal standard for analysis of sterols in plasma by GC and HPLC. | | Definition | ChEBI: Epi-coprostanol is a cholestanoid. | | Biochem/physiol Actions | 5β-Cholestan-3α-ol is a sterol produced endogenously from cholesterol and has been isolated from feces of human and rats. It is derived from cholesterol by the action of intestinal microorganisms. |
| | 5BETA-CHOLESTAN-3ALPHA-OL Preparation Products And Raw materials |
|