| Company Name: |
Struchem Co., Ltd. Gold |
| Tel: |
0512-63009836 18994340901 |
| Email: |
helen@struchem.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Dimethylamino-2-nitroethylene Basic information |
| Product Name: | 1-Dimethylamino-2-nitroethylene | | Synonyms: | 1-(N,N-Dimethylamino)-2-nitroethylene;1-Nitro-2-(dimethylamino)ethylene;N-(2-Nitrovinyl)dimethylamine;N,N-Dimethyl-2-nitrovinylamine;DiMethylaMino nitroethylene;EthenaMine, N,N-diMethyl-2-nitro-;N,N-dimethyl-2-nitroethen-1-amine;N,N-DIMETHYL-N-(2-NITROVINYL)AMINE | | CAS: | 1190-92-7 | | MF: | C4H8N2O2 | | MW: | 116.12 | | EINECS: | 628-409-5 | | Product Categories: | | | Mol File: | 1190-92-7.mol |  |
| | 1-Dimethylamino-2-nitroethylene Chemical Properties |
| Melting point | 103-107 °C(lit.) | | Boiling point | 161℃ | | density | 1.073 | | Fp | 51℃ | | storage temp. | 2-8°C | | solubility | sol alcohols, ethers, chloroform, acetone; slightly sol n-hexane | | form | crystalline solid | | pka | 2.71±0.70(Predicted) | | color | Orange | | BRN | 1903136 | | InChI | InChI=1S/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3 | | InChIKey | JKOVQYWMFZTKMX-ONEGZZNKSA-N | | SMILES | C(N(C)C)=C[N+]([O-])=O | | CAS DataBase Reference | 1190-92-7(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37/38-41-43 | | Safety Statements | 26-36/37/39-45 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, KEEP COLD | | HS Code | 29211990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 1-Dimethylamino-2-nitroethylene Usage And Synthesis |
| Uses | 1-Dimethylamino-2-nitroethylene is widely used in organic reactions. | | Uses | 1-(Dimethylamino)-2-nitroethylene undergoes addition-elimination reaction with indoles to form the corresponding 3-(2-nitrovinyl)indoles. | | Preparation | 1-Dimethylamino-2-nitroethylene can be prepared by reaction of N,N-Dimethylformamide Diethyl Acetal (85% yield) or N,N-Dimethylformamide-Dimethyl Sulfate complex (60%) with Nitromethane; condensation of Triethyl Orthoformate with MeNO2 in the presence of DMF (52%), or addition-elimination reaction of 1-Nitro-2-phenylthioethylene with Me2NH (74%). |
| | 1-Dimethylamino-2-nitroethylene Preparation Products And Raw materials |
|