| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy Basic information |
| Product Name: | 2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy | | Synonyms: | 2,2,6,6-tetramethyl-4-(methylsulfonyloxy)-1-piper;2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy,free radical;1-Piperidinyloxy, 2,2,6,6-tetramethyl-4-[(methylsulfonyl)oxy]-;Nsc300603;4-methanesulfonyl-2,2,6,6-tetramethyl-1-piperidinyloxy radical;1-HYDROXY-2,2,6,6-TETRAMETHYLPIPERIDIN-4-YL METHANESULFONATE;2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy | | CAS: | 35203-66-8 | | MF: | C10H20NO4S | | MW: | 250.34 | | EINECS: | | | Product Categories: | Radical Chemistry;Stable Radicals;TEMPO Derivatives | | Mol File: | 35203-66-8.mol |  |
| | 2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy Chemical Properties |
| Melting point | 90-92 °C (lit.) | | form | solid | | InChI | 1S/C10H21NO4S/c1-9(2)6-8(15-16(5,13)14)7-10(3,4)11(9)12/h8,11H,6-7H2,1-5H3 | | InChIKey | FWQKPTXRJZOQGN-UHFFFAOYSA-N | | SMILES | CC1(C)CC(CC(C)(C)N1[O])OS(C)(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy Usage And Synthesis |
| | 2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy Preparation Products And Raw materials |
|