| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Ethyl trimethylsilyldifluoroacetate manufacturers
|
| | Ethyl trimethylsilyldifluoroacetate Basic information |
| Product Name: | Ethyl trimethylsilyldifluoroacetate | | Synonyms: | Ethyl 2,2-difluoro-2-(trimethylsilanyl)acetate;Ethyl 2,2-Difluoro-2-(trimethylsilyl)acetate;2,2-DIFLUORO-2-(TRIMETHYLSILYL)ACETIC ACID ETHYL ESTER;Difluoro(trimethylsilyl)acetic acid ethyl ester, Ethyl 2,2-difluoro-2-(trimethylsilyl)ethanoate;Ethyl difluoro(trimethylsilyl)acetate;2-(trimethylsilyl)-2,2-difluoride ethyl acetate;Ethyl difluoro(trimethylsilyl)acetate 95%;Acetic acid, 2,2-difluoro-2-(trimethylsilyl)-, ethyl ester | | CAS: | 205865-67-4 | | MF: | C7H14F2O2Si | | MW: | 196.27 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Ethyl trimethylsilyldifluoroacetate Chemical Properties |
| Boiling point | 55°C/20mmHg(lit.) | | density | 1.010±0.06 g/cm3(Predicted) | | refractive index | 1.3930 to 1.3970 | | storage temp. | Storage temp. 2-8°C | | form | clear liquid to cloudy liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C7H14F2O2Si/c1-5-11-6(10)7(8,9)12(2,3)4/h5H2,1-4H3 | | InChIKey | DYAKYYSMROBYNG-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(F)(F)[Si](C)(C)C |
| RIDADR | UN 3272 3/PG III | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2915390090 |
| | Ethyl trimethylsilyldifluoroacetate Usage And Synthesis |
| Uses | Ethyl 2,2-difluoro-2-(trimethylsilyl)acetate is a reagent for organic difluoromethylation and difluoromethylenation reactions. |
| | Ethyl trimethylsilyldifluoroacetate Preparation Products And Raw materials |
|