| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Tetraisopropylthiuram disulfide manufacturers
|
| | Tetraisopropylthiuram disulfide Basic information |
| | Tetraisopropylthiuram disulfide Chemical Properties |
| Melting point | 115-117 °C (lit.) | | Boiling point | 408.5±28.0 °C(Predicted) | | density | 1.124±0.06 g/cm3(Predicted) | | solubility | chloroform: soluble2.5%, clear, yellow | | form | powder to crystal | | pka | 0.75±0.50(Predicted) | | color | White to Light yellow | | InChI | 1S/C14H28N2S4/c1-9(2)15(10(3)4)13(17)19-20-14(18)16(11(5)6)12(7)8/h9-12H,1-8H3 | | InChIKey | ZUYREEAWHZRZDX-UHFFFAOYSA-N | | SMILES | CC(C)N(C(C)C)C(=S)SSC(=S)N(C(C)C)C(C)C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29303000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetraisopropylthiuram disulfide Usage And Synthesis |
| Chemical Properties | Tan powder; amine odor. Soluble in benzene,
chloroform, gasoline; insoluble in water, 10%
caustic, carbon disulfide. | | Uses | Tetraisopropylthiuram disulphide has been used:
- for incorporation of a thiol equivalent into heterocyclic compounds, by reaction with appropriate lithiated heterocycle
- in preparation of unsymmetrical sulfides
- as extractant for silver (I) extraction from photographic fixing solution
| | Uses | Rubber accelerator. |
| | Tetraisopropylthiuram disulfide Preparation Products And Raw materials |
|