| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(4-Methylbenzoyl)acrylic acid Basic information |
| | 3-(4-Methylbenzoyl)acrylic acid Chemical Properties |
| Melting point | 138-140 °C(lit.) | | Boiling point | 361.8±42.0 °C(Predicted) | | density | 1.200±0.06 g/cm3(Predicted) | | pka | 3.22±0.10(Predicted) | | form | solid | | BRN | 2691231 | | InChI | 1S/C11H10O3/c1-8-2-4-9(5-3-8)10(12)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+ | | InChIKey | VNJMEFZKYZHWEO-VOTSOKGWSA-N | | SMILES | Cc1ccc(cc1)C(=O)\C=C\C(O)=O | | CAS DataBase Reference | 20972-36-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2918300090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(4-Methylbenzoyl)acrylic acid Usage And Synthesis |
| Definition | ChEBI: 3-(4-methylbenzoyl)acrylic acid is a carbonyl compound. |
| | 3-(4-Methylbenzoyl)acrylic acid Preparation Products And Raw materials |
|